C23H32O8 — CID 163066593
[5-acetyloxy-4,7-dihydroxy-9a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-8-methylidene-2-oxo-4,5,6,7,8a,9-hexahydro-1H-cyclopenta[f]azulen-9-yl] acetate (PubChem CID 163066593) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is [5-acetyloxy-4,7-dihydroxy-9a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-8-methylidene-2-oxo-4,5,6,7,8a,9-hexahydro-1H-cyclopenta[f]azulen-9-yl] acetate.
| Compound Name | [5-acetyloxy-4,7-dihydroxy-9a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-8-methylidene-2-oxo-4,5,6,7,8a,9-hexahydro-1H-cyclopenta[f]azulen-9-yl] acetate |
|---|---|
| PubChem CID | 163066593 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [5-acetyloxy-4,7-dihydroxy-9a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-8-methylidene-2-oxo-4,5,6,7,8a,9-hexahydro-1H-cyclopenta[f]azulen-9-yl] acetate |
| SMILES | C=C1C(O)CC2(C)C(OC(C)=O)C(O)C3=C(C)C(=O)CC3(C(C)(C)O)C(OC(C)=O)C12 |
| InChI | InChI=1S/C23H32O8/c1-10-15(27)9-23(21(5,6)29)16(10)18(28)20(31-13(4)25)22(7)8-14(26)11(2)17(22)19(23)30-12(3)24/h14,17-20,26,28-29H,2,8-9H2,1,3-7H3 |
| InChIKey | NQQDPSJHQWSGPG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|