C17H26O3 — CID 11055014
[(1S,2S,6S,7S,9S,11S)-9-hydroxy-1,2,6-trimethyl-8-methylidene-11-tricyclo[5.3.1.02,6]undecanyl] acetate (PubChem CID 11055014) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(1S,2S,6S,7S,9S,11S)-9-hydroxy-1,2,6-trimethyl-8-methylidene-11-tricyclo[5.3.1.02,6]undecanyl] acetate.
| Compound Name | [(1S,2S,6S,7S,9S,11S)-9-hydroxy-1,2,6-trimethyl-8-methylidene-11-tricyclo[5.3.1.02,6]undecanyl] acetate |
|---|---|
| PubChem CID | 11055014 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(1S,2S,6S,7S,9S,11S)-9-hydroxy-1,2,6-trimethyl-8-methylidene-11-tricyclo[5.3.1.02,6]undecanyl] acetate |
| SMILES | C=C1[C@@H](O)C[C@]2(C)[C@@H](OC(C)=O)[C@H]1[C@]1(C)CCC[C@@]12C |
| InChI | InChI=1S/C17H26O3/c1-10-12(19)9-16(4)14(20-11(2)18)13(10)15(3)7-6-8-17(15,16)5/h12-14,19H,1,6-9H2,2-5H3/t12-,13-,14-,15-,16+,17-/m0/s1 |
| InChIKey | CFIDXWRIKPLFPH-JNNCMOEMSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|