C17H26O3 — CID 91750175
[(1'S,2S,2'R,6'S,9'R)-1',2',6'-trimethylspiro[oxirane-2,8'-tricyclo[5.3.1.02,6]undecane]-9'-yl] acetate (PubChem CID 91750175) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(1'S,2S,2'R,6'S,9'R)-1',2',6'-trimethylspiro[oxirane-2,8'-tricyclo[5.3.1.02,6]undecane]-9'-yl] acetate.
| Compound Name | [(1'S,2S,2'R,6'S,9'R)-1',2',6'-trimethylspiro[oxirane-2,8'-tricyclo[5.3.1.02,6]undecane]-9'-yl] acetate |
|---|---|
| PubChem CID | 91750175 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(1'S,2S,2'R,6'S,9'R)-1',2',6'-trimethylspiro[oxirane-2,8'-tricyclo[5.3.1.02,6]undecane]-9'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@]2(C)CC([C@]3(C)CCC[C@]23C)[C@]12CO2 |
| InChI | InChI=1S/C17H26O3/c1-11(18)20-13-9-14(2)8-12(17(13)10-19-17)15(3)6-5-7-16(14,15)4/h12-13H,5-10H2,1-4H3/t12?,13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | RPIPUNFNXUXZEF-HUVXYLLVSA-N |
| XLogP | 3.31 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|