C21H36O2 — CID 134577052
[(2R,4aS,4bS,8aS,10aS)-3,4a,4b,8,8-pentamethyl-2,3,4,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-2-yl] acetate (PubChem CID 134577052) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is [(2R,4aS,4bS,8aS,10aS)-3,4a,4b,8,8-pentamethyl-2,3,4,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-2-yl] acetate.
| Compound Name | [(2R,4aS,4bS,8aS,10aS)-3,4a,4b,8,8-pentamethyl-2,3,4,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 134577052 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | [(2R,4aS,4bS,8aS,10aS)-3,4a,4b,8,8-pentamethyl-2,3,4,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2CC[C@H]3C(C)(C)CCC[C@]3(C)[C@@]2(C)CC1C |
| InChI | InChI=1S/C21H36O2/c1-14-13-21(6)16(12-17(14)23-15(2)22)8-9-18-19(3,4)10-7-11-20(18,21)5/h14,16-18H,7-13H2,1-6H3/t14?,16-,17+,18-,20-,21-/m0/s1 |
| InChIKey | KQHNLMFFGZCFSU-IFANOYMFSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |