C31H34O9 — CID 44585212
[(4R,5R,5aR,9aS,10S,10aS)-5,10-diacetyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,8-dioxo-4,5,9a,10-tetrahydro-1H-benzo[g]azulen-4-yl] benzoate (PubChem CID 44585212) has the molecular formula C31H34O9 and a molecular weight of 550.60 g/mol. Its IUPAC name is [(4R,5R,5aR,9aS,10S,10aS)-5,10-diacetyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,8-dioxo-4,5,9a,10-tetrahydro-1H-benzo[g]azulen-4-yl] benzoate.
| Compound Name | [(4R,5R,5aR,9aS,10S,10aS)-5,10-diacetyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,8-dioxo-4,5,9a,10-tetrahydro-1H-benzo[g]azulen-4-yl] benzoate |
|---|---|
| PubChem CID | 44585212 |
| Molecular Formula | C31H34O9 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [(4R,5R,5aR,9aS,10S,10aS)-5,10-diacetyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,8-dioxo-4,5,9a,10-tetrahydro-1H-benzo[g]azulen-4-yl] benzoate |
| SMILES | C=C1C(=O)C=C[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(=O)c3ccccc3)C3=C(C)C(=O)C[C@@]3(C(C)(C)O)[C@@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C31H34O9/c1-16-21(34)13-14-30(7)24(16)26(38-18(3)32)31(29(5,6)37)15-22(35)17(2)23(31)25(27(30)39-19(4)33)40-28(36)20-11-9-8-10-12-20/h8-14,24-27,37H,1,15H2,2-7H3/t24-,25+,26-,27-,30+,31-/m0/s1 |
| InChIKey | WACGZKKRTYRGGY-HWNYZPKOSA-N |
| XLogP | 3.45 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|