C34H44O7 — CID 162836207
(10,13-diacetyloxy-9-hydroxy-3,8,12,15,15-pentamethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-phenylprop-2-enoate (PubChem CID 162836207) has the molecular formula C34H44O7 and a molecular weight of 564.72 g/mol. Its IUPAC name is (10,13-diacetyloxy-9-hydroxy-3,8,12,15,15-pentamethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-phenylprop-2-enoate.
| Compound Name | (10,13-diacetyloxy-9-hydroxy-3,8,12,15,15-pentamethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162836207 |
| Molecular Formula | C34H44O7 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | (10,13-diacetyloxy-9-hydroxy-3,8,12,15,15-pentamethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-phenylprop-2-enoate |
| SMILES | C=C1C(OC(=O)C=Cc2ccccc2)CCC2(C)C(O)C(OC(C)=O)C3=C(C)C(OC(C)=O)CC(CC12C)C3(C)C |
| InChI | InChI=1S/C34H44O7/c1-20-27(39-22(3)35)18-25-19-34(8)21(2)26(41-28(37)15-14-24-12-10-9-11-13-24)16-17-33(34,7)31(38)30(40-23(4)36)29(20)32(25,5)6/h9-15,25-27,30-31,38H,2,16-19H2,1,3-8H3 |
| InChIKey | CQRFHOWCNZAKAM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|