C33H40O7 — CID 10875292
[(1R,2R,3R,4R,7S,9S,11R,14S)-2,3-diacetyloxy-4,14,15,15-tetramethyl-8-methylidene-13-oxo-7-tetracyclo[9.3.1.01,9.04,9]pentadecanyl] (E)-3-phenylprop-2-enoate (PubChem CID 10875292) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(1R,2R,3R,4R,7S,9S,11R,14S)-2,3-diacetyloxy-4,14,15,15-tetramethyl-8-methylidene-13-oxo-7-tetracyclo[9.3.1.01,9.04,9]pentadecanyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R,2R,3R,4R,7S,9S,11R,14S)-2,3-diacetyloxy-4,14,15,15-tetramethyl-8-methylidene-13-oxo-7-tetracyclo[9.3.1.01,9.04,9]pentadecanyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 10875292 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | [(1R,2R,3R,4R,7S,9S,11R,14S)-2,3-diacetyloxy-4,14,15,15-tetramethyl-8-methylidene-13-oxo-7-tetracyclo[9.3.1.01,9.04,9]pentadecanyl] (E)-3-phenylprop-2-enoate |
| SMILES | C=C1[C@@H](OC(=O)/C=C/c2ccccc2)CC[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]34[C@H](C)C(=O)C[C@@H](C[C@@]132)C4(C)C |
| InChI | InChI=1S/C33H40O7/c1-19-25(36)17-24-18-32-20(2)26(40-27(37)14-13-23-11-9-8-10-12-23)15-16-31(32,7)28(38-21(3)34)29(39-22(4)35)33(19,32)30(24,5)6/h8-14,19,24,26,28-29H,2,15-18H2,1,3-7H3/b14-13+/t19-,24+,26+,28+,29+,31+,32+,33-/m1/s1 |
| InChIKey | CTCUFNSATHDLRX-FPEAYMKVSA-N |
| XLogP | 5.47 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|