C37H46O11 — CID 163054352
[(1R,2R,3R,5S,8R,9R,10S,11S)-2,9,10,13-tetraacetyloxy-11-hydroxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-12-enyl] (Z)-3-phenylprop-2-enoate (PubChem CID 163054352) has the molecular formula C37H46O11 and a molecular weight of 666.76 g/mol. Its IUPAC name is [(1R,2R,3R,5S,8R,9R,10S,11S)-2,9,10,13-tetraacetyloxy-11-hydroxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-12-enyl] (Z)-3-phenylprop-2-enoate.
| Compound Name | [(1R,2R,3R,5S,8R,9R,10S,11S)-2,9,10,13-tetraacetyloxy-11-hydroxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-12-enyl] (Z)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163054352 |
| Molecular Formula | C37H46O11 |
| Molecular Weight | 666.76 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | [(1R,2R,3R,5S,8R,9R,10S,11S)-2,9,10,13-tetraacetyloxy-11-hydroxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-12-enyl] (Z)-3-phenylprop-2-enoate |
| SMILES | C=C1[C@@H](OC(=O)/C=C\c2ccccc2)CC[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]3(O)C(C)=C(OC(C)=O)C[C@@H]([C@@H](OC(C)=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C37H46O11/c1-20-28(48-30(42)16-15-26-13-11-10-12-14-26)17-18-36(9)31(20)32(45-23(4)39)27-19-29(44-22(3)38)21(2)37(43,35(27,7)8)34(47-25(6)41)33(36)46-24(5)40/h10-16,27-28,31-34,43H,1,17-19H2,2-9H3/b16-15-/t27-,28-,31-,32+,33-,34-,36+,37-/m0/s1 |
| InChIKey | OURIUJQBZPXKRV-FTIAGSNPSA-N |
| XLogP | 5.01 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|