C36H49NO9 — CID 85407801
(2,10,13-triacetyloxy-9-hydroxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-(methylamino)-3-phenylpropanoate (PubChem CID 85407801) has the molecular formula C36H49NO9 and a molecular weight of 639.79 g/mol. Its IUPAC name is (2,10,13-triacetyloxy-9-hydroxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-(methylamino)-3-phenylpropanoate.
| Compound Name | (2,10,13-triacetyloxy-9-hydroxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-(methylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 85407801 |
| Molecular Formula | C36H49NO9 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.34 |
| IUPAC Name | (2,10,13-triacetyloxy-9-hydroxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-(methylamino)-3-phenylpropanoate |
| SMILES | C=C1C(OC(=O)CC(NC)c2ccccc2)CCC2(C)C(O)C(OC(C)=O)C3=C(C)C(OC(C)=O)CC(C(OC(C)=O)C12)C3(C)C |
| InChI | InChI=1S/C36H49NO9/c1-19-27(46-29(41)18-26(37-9)24-13-11-10-12-14-24)15-16-36(8)31(19)32(44-22(4)39)25-17-28(43-21(3)38)20(2)30(35(25,6)7)33(34(36)42)45-23(5)40/h10-14,25-28,31-34,37,42H,1,15-18H2,2-9H3 |
| InChIKey | XWHQVFNFMPEWQA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|