C43H57NO14 — CID 22210047
[(1R,3R,8S)-2,7,9,10,13-pentaacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 2-acetyloxy-3-(dimethylamino)-3-phenylpropanoate (PubChem CID 22210047) has the molecular formula C43H57NO14 and a molecular weight of 811.92 g/mol. Its IUPAC name is [(1R,3R,8S)-2,7,9,10,13-pentaacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 2-acetyloxy-3-(dimethylamino)-3-phenylpropanoate.
| Compound Name | [(1R,3R,8S)-2,7,9,10,13-pentaacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 2-acetyloxy-3-(dimethylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 22210047 |
| Molecular Formula | C43H57NO14 |
| Molecular Weight | 811.92 g/mol |
| Exact Mass | 811.38 |
| IUPAC Name | [(1R,3R,8S)-2,7,9,10,13-pentaacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 2-acetyloxy-3-(dimethylamino)-3-phenylpropanoate |
| SMILES | C=C1C(OC(=O)C(OC(C)=O)C(c2ccccc2)N(C)C)CC(OC(C)=O)[C@@]2(C)C(OC(C)=O)C(OC(C)=O)C3=C(C)C(OC(C)=O)C[C@@H](C(OC(C)=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C43H57NO14/c1-21-31(52-23(3)45)19-30-37(54-25(5)47)35-22(2)32(58-41(51)39(56-27(7)49)36(44(12)13)29-17-15-14-16-18-29)20-33(53-24(4)46)43(35,11)40(57-28(8)50)38(55-26(6)48)34(21)42(30,9)10/h14-18,30-33,35-40H,2,19-20H2,1,3-13H3/t30-,31?,32?,33?,35-,36?,37?,38?,39?,40?,43+/m0/s1 |
| InChIKey | CVEPDRIMXHVKMP-RLVOKPPQSA-N |
| XLogP | 4.75 |
| TPSA | 187.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|