C35H47NO10 — CID 14446190
(7,9-diacetyloxy-13,14-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-10-oxo-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-(dimethylamino)-2-hydroxy-3-phenylpropanoate (PubChem CID 14446190) has the molecular formula C35H47NO10 and a molecular weight of 641.76 g/mol. Its IUPAC name is (7,9-diacetyloxy-13,14-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-10-oxo-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-(dimethylamino)-2-hydroxy-3-phenylpropanoate.
| Compound Name | (7,9-diacetyloxy-13,14-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-10-oxo-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-(dimethylamino)-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 14446190 |
| Molecular Formula | C35H47NO10 |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.32 |
| IUPAC Name | (7,9-diacetyloxy-13,14-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-10-oxo-5-tricyclo[9.3.1.03,8]pentadec-11-enyl) 3-(dimethylamino)-2-hydroxy-3-phenylpropanoate |
| SMILES | C=C1C(OC(=O)C(O)C(c2ccccc2)N(C)C)CC(OC(C)=O)C2(C)C1CC1C(O)C(O)C(C)=C(C(=O)C2OC(C)=O)C1(C)C |
| InChI | InChI=1S/C35H47NO10/c1-17-22-15-23-29(40)28(39)18(2)26(34(23,5)6)30(41)32(45-20(4)38)35(22,7)25(44-19(3)37)16-24(17)46-33(43)31(42)27(36(8)9)21-13-11-10-12-14-21/h10-14,22-25,27-29,31-32,39-40,42H,1,15-16H2,2-9H3 |
| InChIKey | ZTQAAYFFZBTOBV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|