C37H47NO10 — CID 163047329
[(1R,2S,5S,7S,8S,13S)-2,7,13-triacetyloxy-8,12,15,15-tetramethyl-9,10-dioxo-5-tricyclo[9.3.1.14,8]hexadeca-3,11-dienyl] (3R)-3-(dimethylamino)-3-phenylpropanoate (PubChem CID 163047329) has the molecular formula C37H47NO10 and a molecular weight of 665.78 g/mol. Its IUPAC name is [(1R,2S,5S,7S,8S,13S)-2,7,13-triacetyloxy-8,12,15,15-tetramethyl-9,10-dioxo-5-tricyclo[9.3.1.14,8]hexadeca-3,11-dienyl] (3R)-3-(dimethylamino)-3-phenylpropanoate.
| Compound Name | [(1R,2S,5S,7S,8S,13S)-2,7,13-triacetyloxy-8,12,15,15-tetramethyl-9,10-dioxo-5-tricyclo[9.3.1.14,8]hexadeca-3,11-dienyl] (3R)-3-(dimethylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 163047329 |
| Molecular Formula | C37H47NO10 |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 665.32 |
| IUPAC Name | [(1R,2S,5S,7S,8S,13S)-2,7,13-triacetyloxy-8,12,15,15-tetramethyl-9,10-dioxo-5-tricyclo[9.3.1.14,8]hexadeca-3,11-dienyl] (3R)-3-(dimethylamino)-3-phenylpropanoate |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@@H](OC(C)=O)C=C3C[C@](C)(C(=O)C(=O)C(=C1C)C2(C)C)[C@@H](OC(C)=O)C[C@@H]3OC(=O)C[C@H](c1ccccc1)N(C)C |
| InChI | InChI=1S/C37H47NO10/c1-20-28(45-21(2)39)16-26-30(46-22(3)40)15-25-19-37(7,35(44)34(43)33(20)36(26,5)6)31(47-23(4)41)18-29(25)48-32(42)17-27(38(8)9)24-13-11-10-12-14-24/h10-15,26-31H,16-19H2,1-9H3/t26-,27+,28-,29-,30-,31-,37-/m0/s1 |
| InChIKey | GTYRAMWEOJXFPW-AIEDMUTBSA-N |
| XLogP | 4.63 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|