C24H28O7 — CID 15971008
[(1E,3R,4R,6S,11S)-3-acetyloxy-7,11,16,16-tetramethyl-9,10,14-trioxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7,12-trienyl] acetate (PubChem CID 15971008) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is [(1E,3R,4R,6S,11S)-3-acetyloxy-7,11,16,16-tetramethyl-9,10,14-trioxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7,12-trienyl] acetate.
| Compound Name | [(1E,3R,4R,6S,11S)-3-acetyloxy-7,11,16,16-tetramethyl-9,10,14-trioxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7,12-trienyl] acetate |
|---|---|
| PubChem CID | 15971008 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [(1E,3R,4R,6S,11S)-3-acetyloxy-7,11,16,16-tetramethyl-9,10,14-trioxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7,12-trienyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@H](OC(C)=O)/C=C3\C[C@@](C)(C=CC3=O)C(=O)C(=O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C24H28O7/c1-12-18(30-13(2)25)10-16-19(31-14(3)26)9-15-11-24(6,8-7-17(15)27)22(29)21(28)20(12)23(16,4)5/h7-9,16,18-19H,10-11H2,1-6H3/b15-9+/t16-,18-,19+,24+/m0/s1 |
| InChIKey | WJPUATONXSJLAG-FFQBYEQHSA-N |
| XLogP | 2.83 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|