C24H32O6 — CID 102177172
[(1Z,3S,4R,6S,9R,11S)-3-acetyloxy-9-hydroxy-7,11,16,16-tetramethyl-10-oxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7,12-trienyl] acetate (PubChem CID 102177172) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is [(1Z,3S,4R,6S,9R,11S)-3-acetyloxy-9-hydroxy-7,11,16,16-tetramethyl-10-oxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7,12-trienyl] acetate.
| Compound Name | [(1Z,3S,4R,6S,9R,11S)-3-acetyloxy-9-hydroxy-7,11,16,16-tetramethyl-10-oxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7,12-trienyl] acetate |
|---|---|
| PubChem CID | 102177172 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(1Z,3S,4R,6S,9R,11S)-3-acetyloxy-9-hydroxy-7,11,16,16-tetramethyl-10-oxo-6-tricyclo[9.3.1.14,8]hexadeca-1,7,12-trienyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@@H](OC(C)=O)/C=C3/CC=C[C@](C)(C3)C(=O)[C@H](O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C24H32O6/c1-13-18(29-14(2)25)11-17-19(30-15(3)26)10-16-8-7-9-24(6,12-16)22(28)21(27)20(13)23(17,4)5/h7,9-10,17-19,21,27H,8,11-12H2,1-6H3/b16-10-/t17-,18-,19-,21+,24+/m0/s1 |
| InChIKey | ZIMQLDATBQTXTK-FRISOASCSA-N |
| XLogP | 3.44 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|