C29H42O10 — CID 162406406
methyl (1R,3R,4S,5S,8R,9R,10R,13S)-5,9,10,13-tetraacetyloxy-8,12,15,15-tetramethyltricyclo[9.3.1.03,8]pentadec-11-ene-4-carboxylate (PubChem CID 162406406) has the molecular formula C29H42O10 and a molecular weight of 550.65 g/mol. Its IUPAC name is methyl (1R,3R,4S,5S,8R,9R,10R,13S)-5,9,10,13-tetraacetyloxy-8,12,15,15-tetramethyltricyclo[9.3.1.03,8]pentadec-11-ene-4-carboxylate.
| Compound Name | methyl (1R,3R,4S,5S,8R,9R,10R,13S)-5,9,10,13-tetraacetyloxy-8,12,15,15-tetramethyltricyclo[9.3.1.03,8]pentadec-11-ene-4-carboxylate |
|---|---|
| PubChem CID | 162406406 |
| Molecular Formula | C29H42O10 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | methyl (1R,3R,4S,5S,8R,9R,10R,13S)-5,9,10,13-tetraacetyloxy-8,12,15,15-tetramethyltricyclo[9.3.1.03,8]pentadec-11-ene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](OC(C)=O)CC[C@]2(C)[C@@H]1C[C@@H]1C[C@H](OC(C)=O)C(C)=C([C@@H](OC(C)=O)[C@@H]2OC(C)=O)C1(C)C |
| InChI | InChI=1S/C29H42O10/c1-14-22(37-16(3)31)13-19-12-20-23(27(34)35-9)21(36-15(2)30)10-11-29(20,8)26(39-18(5)33)25(38-17(4)32)24(14)28(19,6)7/h19-23,25-26H,10-13H2,1-9H3/t19-,20-,21+,22+,23+,25-,26+,29-/m1/s1 |
| InChIKey | WGKBUQCVLLMAHX-CRMXLOGKSA-N |
| XLogP | 3.68 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|