C28H40O9 — CID 10875024
[(1R,3R,7S,8S,9R,10R,13S)-9,10,13-triacetyloxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-7-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl] acetate (PubChem CID 10875024) has the molecular formula C28H40O9 and a molecular weight of 520.62 g/mol. Its IUPAC name is [(1R,3R,7S,8S,9R,10R,13S)-9,10,13-triacetyloxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-7-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl] acetate.
| Compound Name | [(1R,3R,7S,8S,9R,10R,13S)-9,10,13-triacetyloxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-7-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl] acetate |
|---|---|
| PubChem CID | 10875024 |
| Molecular Formula | C28H40O9 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [(1R,3R,7S,8S,9R,10R,13S)-9,10,13-triacetyloxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-7-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2C[C@@H]3C(CO)=CC[C@H](OC(C)=O)[C@@]3(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C28H40O9/c1-14-22(34-15(2)30)12-20-11-21-19(13-29)9-10-23(35-16(3)31)28(21,8)26(37-18(5)33)25(36-17(4)32)24(14)27(20,6)7/h9,20-23,25-26,29H,10-13H2,1-8H3/t20-,21-,22+,23+,25-,26+,28+/m1/s1 |
| InChIKey | BVLCGWPYMQDZNT-JXJVIWGUSA-N |
| XLogP | 3.42 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|