C27H40O8 — CID 162841132
[9-acetyloxy-2,5,13-trihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-(2-oxopropyl)-10-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 162841132) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is [9-acetyloxy-2,5,13-trihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-(2-oxopropyl)-10-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [9-acetyloxy-2,5,13-trihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-(2-oxopropyl)-10-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 162841132 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [9-acetyloxy-2,5,13-trihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-(2-oxopropyl)-10-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | C=C1C(O)CC(CC(C)=O)C2(C)C(OC(C)=O)C(OC(C)=O)C3=C(C)C(O)CC(C(O)C12)C3(C)C |
| InChI | InChI=1S/C27H40O8/c1-12(28)9-17-10-19(31)13(2)21-23(33)18-11-20(32)14(3)22(26(18,6)7)24(34-15(4)29)25(27(17,21)8)35-16(5)30/h17-21,23-25,31-33H,2,9-11H2,1,3-8H3 |
| InChIKey | MMANBQDRSFEOMM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|