C25H34O7 — CID 162847442
methyl 5,6-diacetyloxy-4,4,11b-trimethyl-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-7-carboxylate (PubChem CID 162847442) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is methyl 5,6-diacetyloxy-4,4,11b-trimethyl-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-7-carboxylate.
| Compound Name | methyl 5,6-diacetyloxy-4,4,11b-trimethyl-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 162847442 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | methyl 5,6-diacetyloxy-4,4,11b-trimethyl-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-7-carboxylate |
| SMILES | COC(=O)C1c2ccoc2CC2C1C(OC(C)=O)C(OC(C)=O)C1C(C)(C)CCCC21C |
| InChI | InChI=1S/C25H34O7/c1-13(26)31-20-19-16(12-17-15(8-11-30-17)18(19)23(28)29-6)25(5)10-7-9-24(3,4)22(25)21(20)32-14(2)27/h8,11,16,18-22H,7,9-10,12H2,1-6H3 |
| InChIKey | YZXSILAXXNXXDW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|