C27H40O8 — CID 15818338
methyl (1R,2S,3R,4S,9R,10R,13R,14R)-2-acetyloxy-3-butanoyloxy-5,5,9-trimethyl-15-oxo-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate (PubChem CID 15818338) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is methyl (1R,2S,3R,4S,9R,10R,13R,14R)-2-acetyloxy-3-butanoyloxy-5,5,9-trimethyl-15-oxo-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate.
| Compound Name | methyl (1R,2S,3R,4S,9R,10R,13R,14R)-2-acetyloxy-3-butanoyloxy-5,5,9-trimethyl-15-oxo-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate |
|---|---|
| PubChem CID | 15818338 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | methyl (1R,2S,3R,4S,9R,10R,13R,14R)-2-acetyloxy-3-butanoyloxy-5,5,9-trimethyl-15-oxo-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate |
| SMILES | CCCC(=O)O[C@H]1[C@@H](OC(C)=O)[C@@]23COC(=O)[C@@H]2[C@H](C(=O)OC)CC[C@@H]3[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C27H40O8/c1-7-9-18(29)35-20-21-25(3,4)12-8-13-26(21,5)17-11-10-16(23(30)32-6)19-24(31)33-14-27(17,19)22(20)34-15(2)28/h16-17,19-22H,7-14H2,1-6H3/t16-,17-,19+,20-,21+,22-,26-,27-/m1/s1 |
| InChIKey | HCUWENRFXCFULR-UEZFYZMHSA-N |
| XLogP | 3.83 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|