C22H32O4 — CID 74432106
(3b,6,6,9a-tetramethyl-1-oxo-3,4,5,5a,7,8,9,9b,10,11-decahydronaphtho[2,1-e][2]benzofuran-10-yl) acetate (PubChem CID 74432106) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (3b,6,6,9a-tetramethyl-1-oxo-3,4,5,5a,7,8,9,9b,10,11-decahydronaphtho[2,1-e][2]benzofuran-10-yl) acetate.
| Compound Name | (3b,6,6,9a-tetramethyl-1-oxo-3,4,5,5a,7,8,9,9b,10,11-decahydronaphtho[2,1-e][2]benzofuran-10-yl) acetate |
|---|---|
| PubChem CID | 74432106 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (3b,6,6,9a-tetramethyl-1-oxo-3,4,5,5a,7,8,9,9b,10,11-decahydronaphtho[2,1-e][2]benzofuran-10-yl) acetate |
| SMILES | CC(=O)OC1CC2=C(COC2=O)C2(C)CCC3C(C)(C)CCCC3(C)C12 |
| InChI | InChI=1S/C22H32O4/c1-13(23)26-16-11-14-15(12-25-19(14)24)21(4)10-7-17-20(2,3)8-6-9-22(17,5)18(16)21/h16-18H,6-12H2,1-5H3 |
| InChIKey | FLSJEPDXKPIBAA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |