C27H40O4 — CID 23425019
(4-hydroxy-5b,8,8,11a,13a-pentamethyl-4,5,5a,6,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[1,2-g][1]benzofuran-13-yl) acetate (PubChem CID 23425019) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is (4-hydroxy-5b,8,8,11a,13a-pentamethyl-4,5,5a,6,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[1,2-g][1]benzofuran-13-yl) acetate.
| Compound Name | (4-hydroxy-5b,8,8,11a,13a-pentamethyl-4,5,5a,6,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[1,2-g][1]benzofuran-13-yl) acetate |
|---|---|
| PubChem CID | 23425019 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (4-hydroxy-5b,8,8,11a,13a-pentamethyl-4,5,5a,6,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[1,2-g][1]benzofuran-13-yl) acetate |
| SMILES | CC(=O)OC1CC2C3(C)CCCC(C)(C)C3CCC2(C)C2CC(O)c3ccoc3C12C |
| InChI | InChI=1S/C27H40O4/c1-16(28)31-22-15-20-25(4)11-7-10-24(2,3)19(25)8-12-26(20,5)21-14-18(29)17-9-13-30-23(17)27(21,22)6/h9,13,18-22,29H,7-8,10-12,14-15H2,1-6H3 |
| InChIKey | LSLQBCYNYZRRON-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |