C23H32O5 — CID 122403904
methyl (4R,4aR,6aS,7R,11aS,11bS)-11b-(acetyloxymethyl)-4,7-dimethyl-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-4-carboxylate (PubChem CID 122403904) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is methyl (4R,4aR,6aS,7R,11aS,11bS)-11b-(acetyloxymethyl)-4,7-dimethyl-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-4-carboxylate.
| Compound Name | methyl (4R,4aR,6aS,7R,11aS,11bS)-11b-(acetyloxymethyl)-4,7-dimethyl-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 122403904 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl (4R,4aR,6aS,7R,11aS,11bS)-11b-(acetyloxymethyl)-4,7-dimethyl-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(COC(C)=O)[C@H]1CC[C@H]1[C@@H](C)c3ccoc3C[C@@H]12 |
| InChI | InChI=1S/C23H32O5/c1-14-16-6-7-20-22(3,21(25)26-4)9-5-10-23(20,13-28-15(2)24)18(16)12-19-17(14)8-11-27-19/h8,11,14,16,18,20H,5-7,9-10,12-13H2,1-4H3/t14-,16+,18+,20+,22-,23+/m1/s1 |
| InChIKey | GCALHVHGIZMZIK-QAUAYMLTSA-N |
| XLogP | 4.49 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |