C22H30O5 — CID 163047545
methyl (1R,2S,9R,10S,13R,14R,17S)-17-methoxy-9-methyl-5,16-dioxapentacyclo[12.3.3.01,13.02,10.04,8]icosa-4(8),6-diene-14-carboxylate (PubChem CID 163047545) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl (1R,2S,9R,10S,13R,14R,17S)-17-methoxy-9-methyl-5,16-dioxapentacyclo[12.3.3.01,13.02,10.04,8]icosa-4(8),6-diene-14-carboxylate.
| Compound Name | methyl (1R,2S,9R,10S,13R,14R,17S)-17-methoxy-9-methyl-5,16-dioxapentacyclo[12.3.3.01,13.02,10.04,8]icosa-4(8),6-diene-14-carboxylate |
|---|---|
| PubChem CID | 163047545 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl (1R,2S,9R,10S,13R,14R,17S)-17-methoxy-9-methyl-5,16-dioxapentacyclo[12.3.3.01,13.02,10.04,8]icosa-4(8),6-diene-14-carboxylate |
| SMILES | COC(=O)[C@@]12CCC[C@@]3([C@@H](OC)OC1)[C@H]1Cc4occc4[C@H](C)[C@@H]1CC[C@@H]23 |
| InChI | InChI=1S/C22H30O5/c1-13-14-5-6-18-21(19(23)24-2)8-4-9-22(18,20(25-3)27-12-21)16(14)11-17-15(13)7-10-26-17/h7,10,13-14,16,18,20H,4-6,8-9,11-12H2,1-3H3/t13-,14+,16+,18+,20+,21+,22-/m1/s1 |
| InChIKey | CFHDLAKXWKVAMW-PWFFDWDHSA-N |
| XLogP | 3.91 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |