C29H38O4 — CID 102502321
[(1S,4aR,6aS,7R,11aS,11bS)-4a-hydroxy-4,4,7,11b-tetramethyl-2,3,5,6,6a,7,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-1-yl] 3-phenylpropanoate (PubChem CID 102502321) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is [(1S,4aR,6aS,7R,11aS,11bS)-4a-hydroxy-4,4,7,11b-tetramethyl-2,3,5,6,6a,7,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-1-yl] 3-phenylpropanoate.
| Compound Name | [(1S,4aR,6aS,7R,11aS,11bS)-4a-hydroxy-4,4,7,11b-tetramethyl-2,3,5,6,6a,7,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-1-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 102502321 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | [(1S,4aR,6aS,7R,11aS,11bS)-4a-hydroxy-4,4,7,11b-tetramethyl-2,3,5,6,6a,7,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-1-yl] 3-phenylpropanoate |
| SMILES | C[C@H]1c2ccoc2C[C@H]2[C@H]1CC[C@@]1(O)C(C)(C)CC[C@H](OC(=O)CCc3ccccc3)[C@]21C |
| InChI | InChI=1S/C29H38O4/c1-19-21-12-16-29(31)27(2,3)15-13-25(33-26(30)11-10-20-8-6-5-7-9-20)28(29,4)23(21)18-24-22(19)14-17-32-24/h5-9,14,17,19,21,23,25,31H,10-13,15-16,18H2,1-4H3/t19-,21+,23+,25+,28+,29-/m1/s1 |
| InChIKey | WMGBPJPQZKQOCZ-HVAGTFAKSA-N |
| XLogP | 6.07 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |