C22H32O6 — CID 78210104
[(1S,4aR,6S,7S,11bS)-4a,6,7-trihydroxy-4,4,7,11b-tetramethyl-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl] acetate (PubChem CID 78210104) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is [(1S,4aR,6S,7S,11bS)-4a,6,7-trihydroxy-4,4,7,11b-tetramethyl-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl] acetate.
| Compound Name | [(1S,4aR,6S,7S,11bS)-4a,6,7-trihydroxy-4,4,7,11b-tetramethyl-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl] acetate |
|---|---|
| PubChem CID | 78210104 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [(1S,4aR,6S,7S,11bS)-4a,6,7-trihydroxy-4,4,7,11b-tetramethyl-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC(C)(C)[C@]2(O)C[C@H](O)C3C(Cc4occc4C3(C)O)[C@@]12C |
| InChI | InChI=1S/C22H32O6/c1-12(23)28-17-6-8-19(2,3)22(26)11-15(24)18-14(20(17,22)4)10-16-13(7-9-27-16)21(18,5)25/h7,9,14-15,17-18,24-26H,6,8,10-11H2,1-5H3/t14?,15-,17-,18?,20-,21?,22+/m0/s1 |
| InChIKey | USEOLSCIUKXXRY-AWXRGARISA-N |
| XLogP | 2.53 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |