C22H32O7 — CID 162869195
(4a,7,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl) acetate (PubChem CID 162869195) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is (4a,7,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl) acetate.
| Compound Name | (4a,7,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl) acetate |
|---|---|
| PubChem CID | 162869195 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (4a,7,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl) acetate |
| SMILES | CC(=O)OC1CCC(C)(C)C2(O)CCC3C(CC4(O)OC(=O)C=C4C3(C)O)C12C |
| InChI | InChI=1S/C22H32O7/c1-12(23)28-16-7-8-18(2,3)22(27)9-6-13-14(19(16,22)4)11-21(26)15(20(13,5)25)10-17(24)29-21/h10,13-14,16,25-27H,6-9,11H2,1-5H3 |
| InChIKey | FMCAONRGNXCJPF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |