C27H38O11 — CID 75306147
(5,6-diacetyloxy-4a,7-dihydroxy-10a-methoxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl) acetate (PubChem CID 75306147) has the molecular formula C27H38O11 and a molecular weight of 538.59 g/mol. Its IUPAC name is (5,6-diacetyloxy-4a,7-dihydroxy-10a-methoxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl) acetate.
| Compound Name | (5,6-diacetyloxy-4a,7-dihydroxy-10a-methoxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl) acetate |
|---|---|
| PubChem CID | 75306147 |
| Molecular Formula | C27H38O11 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (5,6-diacetyloxy-4a,7-dihydroxy-10a-methoxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-1-yl) acetate |
| SMILES | COC12CC3C(C(OC(C)=O)C(OC(C)=O)C4(O)C(C)(C)CCC(OC(C)=O)C34C)C(C)(O)C1=CC(=O)O2 |
| InChI | InChI=1S/C27H38O11/c1-13(28)35-18-9-10-23(4,5)27(33)22(37-15(3)30)21(36-14(2)29)20-16(24(18,27)6)12-26(34-8)17(25(20,7)32)11-19(31)38-26/h11,16,18,20-22,32-33H,9-10,12H2,1-8H3 |
| InChIKey | YHARKLBLKUZZPX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|