C28H42O11 — CID 162863416
(5,6-diacetyloxy-4a,7-dihydroxy-9,10a-dimethoxy-4,4,7,11b-tetramethyl-2,3,5,6,6a,9,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-1-yl) acetate (PubChem CID 162863416) has the molecular formula C28H42O11 and a molecular weight of 554.63 g/mol. Its IUPAC name is (5,6-diacetyloxy-4a,7-dihydroxy-9,10a-dimethoxy-4,4,7,11b-tetramethyl-2,3,5,6,6a,9,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-1-yl) acetate.
| Compound Name | (5,6-diacetyloxy-4a,7-dihydroxy-9,10a-dimethoxy-4,4,7,11b-tetramethyl-2,3,5,6,6a,9,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-1-yl) acetate |
|---|---|
| PubChem CID | 162863416 |
| Molecular Formula | C28H42O11 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (5,6-diacetyloxy-4a,7-dihydroxy-9,10a-dimethoxy-4,4,7,11b-tetramethyl-2,3,5,6,6a,9,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-1-yl) acetate |
| SMILES | COC1C=C2C(OC)(CC3C(C(OC(C)=O)C(OC(C)=O)C4(O)C(C)(C)CCC(OC(C)=O)C34C)C2(C)O)O1 |
| InChI | InChI=1S/C28H42O11/c1-14(29)36-19-10-11-24(4,5)28(33)23(38-16(3)31)22(37-15(2)30)21-17(25(19,28)6)13-27(35-9)18(26(21,7)32)12-20(34-8)39-27/h12,17,19-23,32-33H,10-11,13H2,1-9H3 |
| InChIKey | ZCNCKAZQUVWHJS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|