C23H40O4Si — CID 53381847
(1S,2R,4S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tricyclo[6.6.1.04,15]pentadec-8(15)-en-12-one (PubChem CID 53381847) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (1S,2R,4S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tricyclo[6.6.1.04,15]pentadec-8(15)-en-12-one.
| Compound Name | (1S,2R,4S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tricyclo[6.6.1.04,15]pentadec-8(15)-en-12-one |
|---|---|
| PubChem CID | 53381847 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (1S,2R,4S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tricyclo[6.6.1.04,15]pentadec-8(15)-en-12-one |
| SMILES | COCO[C@@H]1C[C@@H]2CCCC3=C2[C@@H]1CCC(=O)CC[C@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O4Si/c1-23(2,3)28(5,6)27-20-13-11-17(24)10-12-19-21(26-15-25-4)14-16-8-7-9-18(20)22(16)19/h16,19-21H,7-15H2,1-6H3/t16-,19+,20+,21+/m0/s1 |
| InChIKey | AQTWIWDVDUNWIO-LLUDDFSJSA-N |
| XLogP | 5.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|