C14H25NO3Si — CID 46844725
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enylpiperidine-2,6-dione (PubChem CID 46844725) has the molecular formula C14H25NO3Si and a molecular weight of 283.44 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enylpiperidine-2,6-dione.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 46844725 |
| Molecular Formula | C14H25NO3Si |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enylpiperidine-2,6-dione |
| SMILES | C=CCN1C(=O)CC[C@@H](O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C14H25NO3Si/c1-7-10-15-12(16)9-8-11(13(15)17)18-19(5,6)14(2,3)4/h7,11H,1,8-10H2,2-6H3/t11-/m1/s1 |
| InChIKey | UUOUSHISDZZDJQ-LLVKDONJSA-N |
| XLogP | 2.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|