C22H35NO3Si — CID 11234665
(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methyl]-6-prop-2-enylpiperidin-2-one (PubChem CID 11234665) has the molecular formula C22H35NO3Si and a molecular weight of 389.61 g/mol. Its IUPAC name is (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methyl]-6-prop-2-enylpiperidin-2-one.
| Compound Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methyl]-6-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 11234665 |
| Molecular Formula | C22H35NO3Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methyl]-6-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCC(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H35NO3Si/c1-8-9-19-20(26-27(6,7)22(2,3)4)14-15-21(24)23(19)16-17-10-12-18(25-5)13-11-17/h8,10-13,19-20H,1,9,14-16H2,2-7H3/t19-,20-/m0/s1 |
| InChIKey | GWYNEVGDWLCPQJ-PMACEKPBSA-N |
| XLogP | 5.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|