C31H53NO4Si2 — CID 71523770
(1R,6S,7S,8S,9S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methyl]-5-azatricyclo[6.3.1.01,5]dodecan-4-one (PubChem CID 71523770) has the molecular formula C31H53NO4Si2 and a molecular weight of 559.94 g/mol. Its IUPAC name is (1R,6S,7S,8S,9S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methyl]-5-azatricyclo[6.3.1.01,5]dodecan-4-one.
| Compound Name | (1R,6S,7S,8S,9S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methyl]-5-azatricyclo[6.3.1.01,5]dodecan-4-one |
|---|---|
| PubChem CID | 71523770 |
| Molecular Formula | C31H53NO4Si2 |
| Molecular Weight | 559.94 g/mol |
| Exact Mass | 559.35 |
| IUPAC Name | (1R,6S,7S,8S,9S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methyl]-5-azatricyclo[6.3.1.01,5]dodecan-4-one |
| SMILES | COc1ccc(C[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3C[C@]4(CCC(=O)N24)CC[C@@H]3O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H53NO4Si2/c1-29(2,3)37(8,9)35-26-16-18-31-19-17-27(33)32(31)25(20-22-12-14-23(34-7)15-13-22)28(24(26)21-31)36-38(10,11)30(4,5)6/h12-15,24-26,28H,16-21H2,1-11H3/t24-,25-,26-,28-,31+/m0/s1 |
| InChIKey | OIIHJFPUMOCCOY-RBSLBNCVSA-N |
| XLogP | 7.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.94 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|