C20H30O6Si — CID 117071050
(4aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methyl]-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 117071050) has the molecular formula C20H30O6Si and a molecular weight of 394.54 g/mol. Its IUPAC name is (4aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methyl]-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
| Compound Name | (4aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methyl]-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 117071050 |
| Molecular Formula | C20H30O6Si |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (4aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methyl]-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
| SMILES | COc1ccc(CC2OC[C@H]3OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O2)cc1 |
| InChI | InChI=1S/C20H30O6Si/c1-20(2,3)27(5,6)26-18-17-15(24-19(18)21)12-23-16(25-17)11-13-7-9-14(22-4)10-8-13/h7-10,15-18H,11-12H2,1-6H3/t15-,16?,17+,18-/m1/s1 |
| InChIKey | WOKDMNFFZGRQJZ-LGFRIEKESA-N |
| XLogP | 3.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|