C21H32O5Si — CID 101429250
(4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethenyl-5-[(4-methoxyphenyl)methoxy]oxan-2-one (PubChem CID 101429250) has the molecular formula C21H32O5Si and a molecular weight of 392.57 g/mol. Its IUPAC name is (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethenyl-5-[(4-methoxyphenyl)methoxy]oxan-2-one.
| Compound Name | (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethenyl-5-[(4-methoxyphenyl)methoxy]oxan-2-one |
|---|---|
| PubChem CID | 101429250 |
| Molecular Formula | C21H32O5Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (4R,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethenyl-5-[(4-methoxyphenyl)methoxy]oxan-2-one |
| SMILES | C=C[C@H]1OC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H32O5Si/c1-8-17-20(24-14-15-9-11-16(23-5)12-10-15)18(13-19(22)25-17)26-27(6,7)21(2,3)4/h8-12,17-18,20H,1,13-14H2,2-7H3/t17-,18-,20-/m1/s1 |
| InChIKey | XGCNBDZECDWIIG-QWFCFKBJSA-N |
| XLogP | 4.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|