C21H27IO6Si — CID 11670979
(4-methoxyphenyl)methyl (1R,2R,6S)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodo-5-oxo-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate (PubChem CID 11670979) has the molecular formula C21H27IO6Si and a molecular weight of 530.43 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (1R,2R,6S)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodo-5-oxo-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (1R,2R,6S)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodo-5-oxo-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
|---|---|
| PubChem CID | 11670979 |
| Molecular Formula | C21H27IO6Si |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | (4-methoxyphenyl)methyl (1R,2R,6S)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodo-5-oxo-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(I)C(=O)[C@H]3O[C@H]3[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H27IO6Si/c1-21(2,3)29(5,6)28-17-14(15(22)16(23)18-19(17)27-18)20(24)26-11-12-7-9-13(25-4)10-8-12/h7-10,17-19H,11H2,1-6H3/t17-,18-,19+/m1/s1 |
| InChIKey | VHGDSCHITBMCDF-QRVBRYPASA-N |
| XLogP | 4.17 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|