C25H41NO3Si — CID 11761828
(1S,6S,7S,8S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methyl]-5-azatricyclo[6.3.1.01,5]dodecan-9-ol (PubChem CID 11761828) has the molecular formula C25H41NO3Si and a molecular weight of 431.69 g/mol. Its IUPAC name is (1S,6S,7S,8S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methyl]-5-azatricyclo[6.3.1.01,5]dodecan-9-ol.
| Compound Name | (1S,6S,7S,8S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methyl]-5-azatricyclo[6.3.1.01,5]dodecan-9-ol |
|---|---|
| PubChem CID | 11761828 |
| Molecular Formula | C25H41NO3Si |
| Molecular Weight | 431.69 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (1S,6S,7S,8S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methyl]-5-azatricyclo[6.3.1.01,5]dodecan-9-ol |
| SMILES | COc1ccc(C[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3C[C@]4(CCCN24)CC[C@H]3O)cc1 |
| InChI | InChI=1S/C25H41NO3Si/c1-24(2,3)30(5,6)29-23-20-17-25(14-12-22(20)27)13-7-15-26(25)21(23)16-18-8-10-19(28-4)11-9-18/h8-11,20-23,27H,7,12-17H2,1-6H3/t20-,21-,22+,23-,25-/m0/s1 |
| InChIKey | AKKCNDMQIWXQEG-NKGRKIGWSA-N |
| XLogP | 5.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|