C24H36O6Si — CID 11351371
(1R,8R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-11-[(4-methoxyphenyl)methoxy]-1-methyl-4,7-dioxatricyclo[6.2.1.02,6]undec-2(6)-en-5-ol (PubChem CID 11351371) has the molecular formula C24H36O6Si and a molecular weight of 448.63 g/mol. Its IUPAC name is (1R,8R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-11-[(4-methoxyphenyl)methoxy]-1-methyl-4,7-dioxatricyclo[6.2.1.02,6]undec-2(6)-en-5-ol.
| Compound Name | (1R,8R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-11-[(4-methoxyphenyl)methoxy]-1-methyl-4,7-dioxatricyclo[6.2.1.02,6]undec-2(6)-en-5-ol |
|---|---|
| PubChem CID | 11351371 |
| Molecular Formula | C24H36O6Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (1R,8R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-11-[(4-methoxyphenyl)methoxy]-1-methyl-4,7-dioxatricyclo[6.2.1.02,6]undec-2(6)-en-5-ol |
| SMILES | COc1ccc(CO[C@H]2[C@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)C2=C(O3)C(O)OC2)cc1 |
| InChI | InChI=1S/C24H36O6Si/c1-23(2,3)31(6,7)30-19-12-18-21(27-13-15-8-10-16(26-5)11-9-15)24(19,4)17-14-28-22(25)20(17)29-18/h8-11,18-19,21-22,25H,12-14H2,1-7H3/t18-,19-,21+,22?,24+/m1/s1 |
| InChIKey | UEIFNAQUBSQMCO-HRCDGWGHSA-N |
| XLogP | 4.38 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|