C26H44O6Si — CID 11598179
[(3aR,4R,5S,6R,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-6-yl]methanol (PubChem CID 11598179) has the molecular formula C26H44O6Si and a molecular weight of 480.72 g/mol. Its IUPAC name is [(3aR,4R,5S,6R,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,5S,6R,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 11598179 |
| Molecular Formula | C26H44O6Si |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | [(3aR,4R,5S,6R,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-6-yl]methanol |
| SMILES | COc1ccc(CO[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)CCC[C@H]3OC(C)(C)O[C@@H]23)cc1 |
| InChI | InChI=1S/C26H44O6Si/c1-25(2,3)33(7,8)32-22-19(16-27)10-9-11-21-23(31-26(4,5)30-21)24(22)29-17-18-12-14-20(28-6)15-13-18/h12-15,19,21-24,27H,9-11,16-17H2,1-8H3/t19-,21-,22+,23-,24+/m1/s1 |
| InChIKey | BBIFVNOADWHJBG-ZXGKGEBGSA-N |
| XLogP | 5.28 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|