C26H44O4Si — CID 10789658
[(1R,2S,5R)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopentyl]methanol (PubChem CID 10789658) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is [(1R,2S,5R)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopentyl]methanol.
| Compound Name | [(1R,2S,5R)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 10789658 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | [(1R,2S,5R)-2-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopentyl]methanol |
| SMILES | COc1ccc(CO[C@@H]2CC[C@@](C)(C/C=C(/C)CO[Si](C)(C)C(C)(C)C)[C@@H]2CO)cc1 |
| InChI | InChI=1S/C26H44O4Si/c1-20(18-30-31(7,8)25(2,3)4)13-15-26(5)16-14-24(23(26)17-27)29-19-21-9-11-22(28-6)12-10-21/h9-13,23-24,27H,14-19H2,1-8H3/b20-13-/t23-,24-,26-/m1/s1 |
| InChIKey | IRQRBODWQCZKGM-NZGCNMIFSA-N |
| XLogP | 6.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|