C24H31ClO3 — CID 134924101
(2E,4E)-5-[(1S,2S,5R)-2-[(Z)-4-chloro-3-methylbut-2-enyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopentyl]penta-2,4-dienal (PubChem CID 134924101) has the molecular formula C24H31ClO3 and a molecular weight of 402.96 g/mol. Its IUPAC name is (2E,4E)-5-[(1S,2S,5R)-2-[(Z)-4-chloro-3-methylbut-2-enyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopentyl]penta-2,4-dienal.
| Compound Name | (2E,4E)-5-[(1S,2S,5R)-2-[(Z)-4-chloro-3-methylbut-2-enyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopentyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 134924101 |
| Molecular Formula | C24H31ClO3 |
| Molecular Weight | 402.96 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2E,4E)-5-[(1S,2S,5R)-2-[(Z)-4-chloro-3-methylbut-2-enyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopentyl]penta-2,4-dienal |
| SMILES | COc1ccc(CO[C@@H]2CC[C@@](C)(C/C=C(/C)CCl)[C@@H]2/C=C/C=C/C=O)cc1 |
| InChI | InChI=1S/C24H31ClO3/c1-19(17-25)12-14-24(2)15-13-23(22(24)7-5-4-6-16-26)28-18-20-8-10-21(27-3)11-9-20/h4-12,16,22-23H,13-15,17-18H2,1-3H3/b6-4+,7-5+,19-12-/t22-,23-,24-/m1/s1 |
| InChIKey | FWSGHENVLNFWPB-MMFKAYHSSA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|