C16H20O3 — CID 10563294
(1R,4S,6S)-6-[(4-methoxyphenyl)methoxy]bicyclo[2.2.2]octan-2-one (PubChem CID 10563294) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (1R,4S,6S)-6-[(4-methoxyphenyl)methoxy]bicyclo[2.2.2]octan-2-one.
| Compound Name | (1R,4S,6S)-6-[(4-methoxyphenyl)methoxy]bicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 10563294 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (1R,4S,6S)-6-[(4-methoxyphenyl)methoxy]bicyclo[2.2.2]octan-2-one |
| SMILES | COc1ccc(CO[C@H]2C[C@@H]3CC[C@H]2C(=O)C3)cc1 |
| InChI | InChI=1S/C16H20O3/c1-18-13-5-2-11(3-6-13)10-19-16-9-12-4-7-14(16)15(17)8-12/h2-3,5-6,12,14,16H,4,7-10H2,1H3/t12-,14+,16+/m1/s1 |
| InChIKey | YZYXGBYDNZGYGM-INWMFGNUSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |