C29H38O5 — CID 11730323
[(3S,8R,9S,10R,13S,14S,15R)-15-[(4-methoxyphenyl)methoxy]-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 11730323) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,15R)-15-[(4-methoxyphenyl)methoxy]-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,15R)-15-[(4-methoxyphenyl)methoxy]-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11730323 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,15R)-15-[(4-methoxyphenyl)methoxy]-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | COc1ccc(CO[C@@H]2CC(=O)[C@@]3(C)CC[C@H]4[C@@H](CC=C5C[C@@H](OC(C)=O)CC[C@@]54C)[C@H]23)cc1 |
| InChI | InChI=1S/C29H38O5/c1-18(30)34-22-11-13-28(2)20(15-22)7-10-23-24(28)12-14-29(3)26(31)16-25(27(23)29)33-17-19-5-8-21(32-4)9-6-19/h5-9,22-25,27H,10-17H2,1-4H3/t22-,23+,24-,25+,27+,28-,29+/m0/s1 |
| InChIKey | UPHMCRAXAQLMIH-FAYBTRNCSA-N |
| XLogP | 5.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|