C28H38O3 — CID 144634886
3-[(4-methoxyphenyl)methoxy]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbaldehyde (PubChem CID 144634886) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methoxy]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbaldehyde.
| Compound Name | 3-[(4-methoxyphenyl)methoxy]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbaldehyde |
|---|---|
| PubChem CID | 144634886 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 3-[(4-methoxyphenyl)methoxy]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbaldehyde |
| SMILES | COc1ccc(COC2CCC3(C)C(=CCC4C3CCC3(C)C(C=O)CCC43)C2)cc1 |
| InChI | InChI=1S/C28H38O3/c1-27-14-12-23(31-18-19-4-8-22(30-3)9-5-19)16-20(27)6-10-24-25-11-7-21(17-29)28(25,2)15-13-26(24)27/h4-6,8-9,17,21,23-26H,7,10-16,18H2,1-3H3 |
| InChIKey | FFVYVRMRDAESHP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|