C26H35NO — CID 167244536
4-[[(3S,10R,13S)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]pyridine (PubChem CID 167244536) has the molecular formula C26H35NO and a molecular weight of 377.57 g/mol. Its IUPAC name is 4-[[(3S,10R,13S)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]pyridine.
| Compound Name | 4-[[(3S,10R,13S)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 167244536 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 4-[[(3S,10R,13S)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]pyridine |
| SMILES | CC1=CCC2C3CC=C4C[C@@H](OCc5ccncc5)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C26H35NO/c1-18-4-7-23-22-6-5-20-16-21(28-17-19-10-14-27-15-11-19)8-12-26(20,3)24(22)9-13-25(18,23)2/h4-5,10-11,14-15,21-24H,6-9,12-13,16-17H2,1-3H3/t21-,22?,23?,24?,25+,26-/m0/s1 |
| InChIKey | GJRGSKUBVUUCTE-LDPAPSECSA-N |
| XLogP | 6.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|