C30H48O5Si — CID 24858141
(1R,4S,4aS,5R,6R,8aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(4-methoxyphenyl)methoxy]-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene-1,6-dicarbaldehyde (PubChem CID 24858141) has the molecular formula C30H48O5Si and a molecular weight of 516.80 g/mol. Its IUPAC name is (1R,4S,4aS,5R,6R,8aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(4-methoxyphenyl)methoxy]-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene-1,6-dicarbaldehyde.
| Compound Name | (1R,4S,4aS,5R,6R,8aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(4-methoxyphenyl)methoxy]-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene-1,6-dicarbaldehyde |
|---|---|
| PubChem CID | 24858141 |
| Molecular Formula | C30H48O5Si |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | (1R,4S,4aS,5R,6R,8aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(4-methoxyphenyl)methoxy]-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene-1,6-dicarbaldehyde |
| SMILES | COc1ccc(CO[C@H]2CC[C@@H](C=O)[C@]3(C)CC[C@@H](C=O)[C@](C)(CCO[Si](C)(C)C(C)(C)C)[C@@H]23)cc1 |
| InChI | InChI=1S/C30H48O5Si/c1-28(2,3)36(7,8)35-18-17-30(5)24(20-32)15-16-29(4)23(19-31)11-14-26(27(29)30)34-21-22-9-12-25(33-6)13-10-22/h9-10,12-13,19-20,23-24,26-27H,11,14-18,21H2,1-8H3/t23-,24-,26-,27-,29-,30-/m0/s1 |
| InChIKey | CXIQSJREYRPSLR-OPQYXRLJSA-N |
| XLogP | 6.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|