C27H44O4Si — CID 10939486
2-[(1S,4S,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopent-2-en-1-yl]acetaldehyde (PubChem CID 10939486) has the molecular formula C27H44O4Si and a molecular weight of 460.73 g/mol. Its IUPAC name is 2-[(1S,4S,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopent-2-en-1-yl]acetaldehyde.
| Compound Name | 2-[(1S,4S,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopent-2-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 10939486 |
| Molecular Formula | C27H44O4Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 2-[(1S,4S,5S)-4-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropyl]-5-[(4-methoxyphenyl)methoxy]-2-methylcyclopent-2-en-1-yl]acetaldehyde |
| SMILES | COc1ccc(CO[C@H]2[C@@H](CC(C)(C)CO[Si](C)(C)C(C)(C)C)C=C(C)[C@@H]2CC=O)cc1 |
| InChI | InChI=1S/C27H44O4Si/c1-20-16-22(17-27(5,6)19-31-32(8,9)26(2,3)4)25(24(20)14-15-28)30-18-21-10-12-23(29-7)13-11-21/h10-13,15-16,22,24-25H,14,17-19H2,1-9H3/t22-,24+,25+/m1/s1 |
| InChIKey | WWMZFYHJRODUBP-VJTSUQJLSA-N |
| XLogP | 6.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|