C21H32O3 — CID 53341855
1-[(1R,2S)-2-[(4-methoxyphenyl)methoxy]-1-methylcyclohexyl]-4-methylpent-3-en-1-ol (PubChem CID 53341855) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(4-methoxyphenyl)methoxy]-1-methylcyclohexyl]-4-methylpent-3-en-1-ol.
| Compound Name | 1-[(1R,2S)-2-[(4-methoxyphenyl)methoxy]-1-methylcyclohexyl]-4-methylpent-3-en-1-ol |
|---|---|
| PubChem CID | 53341855 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 1-[(1R,2S)-2-[(4-methoxyphenyl)methoxy]-1-methylcyclohexyl]-4-methylpent-3-en-1-ol |
| SMILES | COc1ccc(CO[C@H]2CCCC[C@]2(C)C(O)CC=C(C)C)cc1 |
| InChI | InChI=1S/C21H32O3/c1-16(2)8-13-19(22)21(3)14-6-5-7-20(21)24-15-17-9-11-18(23-4)12-10-17/h8-12,19-20,22H,5-7,13-15H2,1-4H3/t19?,20-,21+/m0/s1 |
| InChIKey | VGCWDIVHWXDVGA-GJGLBJJNSA-N |
| XLogP | 4.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|