C23H34O5 — CID 22661148
5-hydroxy-3-methoxy-4-[(4-methoxyphenyl)methoxy]-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one (PubChem CID 22661148) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 5-hydroxy-3-methoxy-4-[(4-methoxyphenyl)methoxy]-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one.
| Compound Name | 5-hydroxy-3-methoxy-4-[(4-methoxyphenyl)methoxy]-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 22661148 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 5-hydroxy-3-methoxy-4-[(4-methoxyphenyl)methoxy]-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one |
| SMILES | COc1ccc(COC2C(O)CC(=O)C(/C(C)=C/CCC(C)C)C2OC)cc1 |
| InChI | InChI=1S/C23H34O5/c1-15(2)7-6-8-16(3)21-19(24)13-20(25)22(23(21)27-5)28-14-17-9-11-18(26-4)12-10-17/h8-12,15,20-23,25H,6-7,13-14H2,1-5H3/b16-8+ |
| InChIKey | IDKDEZPMHAIHLO-LZYBPNLTSA-N |
| XLogP | 3.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|