C23H34O5 — CID 101096069
ethyl (2S)-2-[(2R,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate (PubChem CID 101096069) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is ethyl (2S)-2-[(2R,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate.
| Compound Name | ethyl (2S)-2-[(2R,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate |
|---|---|
| PubChem CID | 101096069 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | ethyl (2S)-2-[(2R,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate |
| SMILES | CCOC(=O)[C@@H](CCC=C(C)C)[C@H]1CC[C@H](OCc2ccc(OC)cc2)CO1 |
| InChI | InChI=1S/C23H34O5/c1-5-26-23(24)21(8-6-7-17(2)3)22-14-13-20(16-28-22)27-15-18-9-11-19(25-4)12-10-18/h7,9-12,20-22H,5-6,8,13-16H2,1-4H3/t20-,21-,22+/m0/s1 |
| InChIKey | PMCSWDQLQBISJV-FDFHNCONSA-N |
| XLogP | 4.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|