C20H31NO4 — CID 122545576
(2S)-N-methoxy-3-[4-[(4-methoxyphenyl)methoxy]cyclohexyl]-N,2-dimethylpropanamide (PubChem CID 122545576) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (2S)-N-methoxy-3-[4-[(4-methoxyphenyl)methoxy]cyclohexyl]-N,2-dimethylpropanamide.
| Compound Name | (2S)-N-methoxy-3-[4-[(4-methoxyphenyl)methoxy]cyclohexyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 122545576 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (2S)-N-methoxy-3-[4-[(4-methoxyphenyl)methoxy]cyclohexyl]-N,2-dimethylpropanamide |
| SMILES | COc1ccc(COC2CCC(C[C@H](C)C(=O)N(C)OC)CC2)cc1 |
| InChI | InChI=1S/C20H31NO4/c1-15(20(22)21(2)24-4)13-16-5-11-19(12-6-16)25-14-17-7-9-18(23-3)10-8-17/h7-10,15-16,19H,5-6,11-14H2,1-4H3/t15-,16?,19?/m0/s1 |
| InChIKey | YAXAOGJXMDAPTE-LYGPFTKASA-N |
| XLogP | 3.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|